| Attributes | Values |
|---|
| rdf:type
| |
| rdfs:label
| - Gluconasturtiine (fr)
- Gluconasturtiin (en)
|
| rdfs:comment
| - La gluconasturtiine (ou phénéthylglucosinolate) est un glucosinolate (hétéroside soufré) qui donne en bouche une impression de feu (irritation). De la racine du raifort à maturité (Armoracia rusticana) ont été extraits plusieurs glucosinolates, majoritairement la sinigrine (83 %) et la gluconasturtiine (11 %). (fr)
|
| rdfs:seeAlso
| - http://echa.europa.eu/substance-information/-/substanceinfo/100.231.959
- http://www.hmdb.ca/metabolites/HMDB0038423
- https://tools.wmflabs.org/magnustools/cas.php?cas=499-30-9
- https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22CKIJIGYDFNXSET-MFIRQCQASA-N%22InChIKey
- https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22CKIJIGYDFNXSET-OOMJLXHVSA-N%22InChIKey
- https://comptox.epa.gov/dashboard/DTXSID70964468
- http://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI=InChI=1S/C15H21NO9S2/c17-8-10-12(18)13(19)14(20)15(24-10)26-11(16-25-27(21,22)23)7-6-9-4-2-1-3-5-9/h1-5,10,12-15,17-20H,6-8H2,(H,21,22,23)/b16-11+/t10-,12-,13+,14-,15+/m1/s1
- http://chemapps.stolaf.edu/jmol/jmol.php?model=C1=CC=C(C=C1)CCC(=NOS(=O)(=O)O)SC2C(C(C(C(O2)CO)O)O)O
- http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=163ENC977A
- http://kanaya.naist.jp/knapsack_jsp/information.jsp?sname=C_ID&word=C00007350
|
| sameAs
| |
| Wikipage page ID
| |
| Wikipage revision ID
| |
| dbo:wikiPageWikiLink
| |
| page length (characters) of wiki page
| |
| dct:subject
| |
| foaf:name
| |
| prop-fr:wikiPageUsesTemplate
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| prop-fr:c
| |
| prop-fr:h
| |
| prop-fr:n
| |
| prop-fr:nom
| |
| prop-fr:nomiupac
| - -3 (xsd:double)
- oxan-2-yl] (fr)
- sulfanylpropylidene]amino} sulfate (fr)
- {[3-phenyl-1-[ (fr)
|
| prop-fr:o
| |
| prop-fr:smiles
| |
| prop-fr:tailleImage
| |
| prop-fr:s
| |
| prop-fr:synonymes
| - * 2-phenylethylglucosinolate;
* 1-S-[3-phenyl-N- (fr)
- propanimidoyl]-1-thio-β-D-glucopyranose (fr)
|
| prop-fr:pubchem
| |
| thumbnail
| |
| foaf:isPrimaryTopicOf
| |
| alternative name
| - propanimidoyl]-1-thio-β-D-glucopyranose (fr)
- * 1-S-[3-phenyl-N-(sulfonatooxy) (fr)
- * 2-phenylethylglucosinolate; (fr)
|
| IUPAC name
| - sulfanylpropylidene]amino} sulfate (fr)
- (hydroxymethyl)oxan-2-yl] (fr)
- -3,4,5-trihydroxy-6- (fr)
- {[3-phenyl-1-[(2S,3R,4S,5S,6R) (fr)
|
| dbo:pubchem
| |
| SMILES
| - C1=CC=C(C=C1)CCC(=NOS(=O)(=O)O)SC2C(C(C(C(O2)CO)O)O)O
|
| weight (g)
| |
| has abstract
| - La gluconasturtiine (ou phénéthylglucosinolate) est un glucosinolate (hétéroside soufré) qui donne en bouche une impression de feu (irritation). De la racine du raifort à maturité (Armoracia rusticana) ont été extraits plusieurs glucosinolates, majoritairement la sinigrine (83 %) et la gluconasturtiine (11 %). (fr)
|
| is dbo:wikiPageWikiLink
of | |
| is Wikipage redirect
of | |
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
![[RDF Data]](/fct/images/sw-rdf-blue.png)
![[cxml]](/fct/images/cxml_doc.png)
![[csv]](/fct/images/csv_doc.png)
![[text]](/fct/images/ntriples_doc.png)
![[turtle]](/fct/images/n3turtle_doc.png)
![[ld+json]](/fct/images/jsonld_doc.png)
![[rdf+json]](/fct/images/json_doc.png)
![[rdf+xml]](/fct/images/xml_doc.png)
![[atom+xml]](/fct/images/atom_doc.png)
![[html]](/fct/images/html_doc.png)
