| Attributes | Values |
|---|
| rdf:type
| |
| rdfs:label
| - Bacillibactine (fr)
- Bacillibactin (en)
|
| rdfs:comment
| - La bacillibactine, ou corynebactine, est un sidérophore produit par des bactéries à Gram positif du genre Bacillus, notamment Bacillus anthracis et Bacillus subtilis. Ce composé est utilisé par ces microorganismes pour chélater des cations de fer ferrique Fe3+ présents à l'extérieur de la cellule afin de les transférer dans leur cytoplasme à l'aide d'un transporteur ABC. (fr)
|
| rdfs:seeAlso
| - https://tools.wmflabs.org/magnustools/cas.php?cas=95536-41-7
- https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22RCQTVEFBFUNTGM-BDVHUIKKSA-N%22InChIKey
- http://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI=InChI=1S/C39H42N6O18/c1-16-28(43-25(49)13-40-34(55)19-7-4-10-22(46)31(19)52)37(58)62-18(3)30(45-27(51)15-42-36(57)21-9-6-12-24(48)33(21)54)39(60)63-17(2)29(38(59)61-16)44-26(50)14-41-35(56)20-8-5-11-23(47)32(20)53/h4-12,16-18,28-30,46-48,52-54H,13-15H2,1-3H3,(H,40,55)(H,41,56)(H,42,57)(H,43,49)(H,44,50)(H,45,51)/t16-,17-,18-,28+,29+,30+/m1/s1
- http://chemapps.stolaf.edu/jmol/jmol.php?model=CC1C(C(=O)OC(C(C(=O)OC(C(C(=O)O1)NC(=O)CNC(=O)C2=C(C(=CC=C2)O)O)C)NC(=O)CNC(=O)C3=C(C(=CC=C3)O)O)C)NC(=O)CNC(=O)C4=C(C(=CC=C4)O)O
- http://www.simolecule.com/cdkdepict/depict/bow/svg?smi=CC@@H1C@@H(C(=O)OC@@H(C@@H(C(=O)OC@@H(C@@H(C(=O)O1)NC(=O)CNC(=O)C2=C(C(=CC=C2)O)O)C)NC(=O)CNC(=O)C3=C(C(=CC=C3)O)O)C)NC(=O)CNC(=O)C4=C(C(=CC=C4)O)O&zoom=2.0&annotate=cip
|
| sameAs
| |
| Wikipage page ID
| |
| Wikipage revision ID
| |
| dbo:wikiPageWikiLink
| |
| page length (characters) of wiki page
| |
| dct:subject
| |
| foaf:name
| |
| prop-fr:wikiPageUsesTemplate
| |
| prov:wasDerivedFrom
| |
| foaf:depiction
| |
| prop-fr:c
| |
| prop-fr:h
| |
| prop-fr:légende
| |
| prop-fr:n
| |
| prop-fr:nom
| |
| prop-fr:nomiupac
| - N,N’,N’’-{[-2,6,10-triméthyl-4,8,12-trioxo-1,5,9-trioxacyclododécane-3,7,11-triyl]tris[imino]}tris (fr)
|
| prop-fr:o
| |
| prop-fr:smiles
| - C[C@H]1OC[C@@H][C@@H]OC[C@@H][C@@H]OC[C@H]1NCCNCc1ccccc1O (fr)
|
| prop-fr:tailleImage
| |
| prop-fr:chebi
| |
| prop-fr:stdinchi
| |
| prop-fr:stdinchikey
| - RCQTVEFBFUNTGM-BDVHUIKKSA-N (fr)
|
| prop-fr:synonymes
| |
| thumbnail
| |
| foaf:isPrimaryTopicOf
| |
| alternative name
| |
| CAS number
| |
| IUPAC name
| - (fr)
- N,N’,N’’-{[(2R,3S,6R,7S,10R,11S)-2,6,10-triméthyl-4,8,12-trioxo-1,5,9-trioxacyclododécane-3,7,11-triyl]tris[imino(2-oxoéthane-2,1-diyl)]}tris(2,3-dihydroxybenzamide) (fr)
|
| dbo:pubchem
| |
| SMILES
| - C[C@H]1OC(=O)[C@@H](NC(=O)CNC(=O)c2cccc(O)c2O)[C@@H](C)OC(=O)[C@@H](NC(=O)CNC(=O)c2cccc(O)c2O)[C@@H](C)OC(=O)[C@H]1NC(=O)CNC(=O)c1cccc(O)c1O
|
| weight (g)
| |
| has abstract
| - La bacillibactine, ou corynebactine, est un sidérophore produit par des bactéries à Gram positif du genre Bacillus, notamment Bacillus anthracis et Bacillus subtilis. Ce composé est utilisé par ces microorganismes pour chélater des cations de fer ferrique Fe3+ présents à l'extérieur de la cellule afin de les transférer dans leur cytoplasme à l'aide d'un transporteur ABC. (fr)
|
| is oa:hasTarget
of | |
| is foaf:primaryTopic
of | |
![[RDF Data]](/fct/images/sw-rdf-blue.png)
![[cxml]](/fct/images/cxml_doc.png)
![[csv]](/fct/images/csv_doc.png)
![[text]](/fct/images/ntriples_doc.png)
![[turtle]](/fct/images/n3turtle_doc.png)
![[ld+json]](/fct/images/jsonld_doc.png)
![[rdf+json]](/fct/images/json_doc.png)
![[rdf+xml]](/fct/images/xml_doc.png)
![[atom+xml]](/fct/images/atom_doc.png)
![[html]](/fct/images/html_doc.png)
